C19H22Si — CID 86083751
1,4-diphenylbuta-1,3-dien-2-yl(trimethyl)silane (PubChem CID 86083751) has the molecular formula C19H22Si and a molecular weight of 278.47 g/mol. Its IUPAC name is 1,4-diphenylbuta-1,3-dien-2-yl(trimethyl)silane.
| Compound Name | 1,4-diphenylbuta-1,3-dien-2-yl(trimethyl)silane |
|---|---|
| PubChem CID | 86083751 |
| Molecular Formula | C19H22Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1,4-diphenylbuta-1,3-dien-2-yl(trimethyl)silane |
| SMILES | C[Si](C)(C)C(C=Cc1ccccc1)=Cc1ccccc1 |
| InChI | InChI=1S/C19H22Si/c1-20(2,3)19(16-18-12-8-5-9-13-18)15-14-17-10-6-4-7-11-17/h4-16H,1-3H3 |
| InChIKey | VVDXSIWNHHQLAS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|