C21H31BO2Si — CID 150068871
trimethyl-[(1E,3E,5E)-1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-1,3,5-trien-2-yl]silane (PubChem CID 150068871) has the molecular formula C21H31BO2Si and a molecular weight of 354.38 g/mol. Its IUPAC name is trimethyl-[(1E,3E,5E)-1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-1,3,5-trien-2-yl]silane.
| Compound Name | trimethyl-[(1E,3E,5E)-1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-1,3,5-trien-2-yl]silane |
|---|---|
| PubChem CID | 150068871 |
| Molecular Formula | C21H31BO2Si |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | trimethyl-[(1E,3E,5E)-1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-1,3,5-trien-2-yl]silane |
| SMILES | CC1(C)OB(/C=C/C=C/C(=C\c2ccccc2)[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C21H31BO2Si/c1-20(2)21(3,4)24-22(23-20)16-12-11-15-19(25(5,6)7)17-18-13-9-8-10-14-18/h8-17H,1-7H3/b15-11+,16-12+,19-17+ |
| InChIKey | DOVWMNYFFRRLKQ-XKHFXBKSSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|