C20H24BNO2 — CID 102044613
N-phenyl-N-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]aniline (PubChem CID 102044613) has the molecular formula C20H24BNO2 and a molecular weight of 321.23 g/mol. Its IUPAC name is N-phenyl-N-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]aniline.
| Compound Name | N-phenyl-N-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 102044613 |
| Molecular Formula | C20H24BNO2 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-phenyl-N-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]aniline |
| SMILES | CC1(C)OB(/C=C/N(c2ccccc2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C20H24BNO2/c1-19(2)20(3,4)24-21(23-19)15-16-22(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16H,1-4H3/b16-15+ |
| InChIKey | ZBLSLQBYRUQPBY-FOCLMDBBSA-N |
| XLogP | 4.97 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|