C19H26BNO2 — CID 102079733
(E)-N-benzyl-N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 102079733) has the molecular formula C19H26BNO2 and a molecular weight of 311.23 g/mol. Its IUPAC name is (E)-N-benzyl-N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | (E)-N-benzyl-N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 102079733 |
| Molecular Formula | C19H26BNO2 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | (E)-N-benzyl-N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | C#CCN(C/C=C/B1OC(C)(C)C(C)(C)O1)Cc1ccccc1 |
| InChI | InChI=1S/C19H26BNO2/c1-6-14-21(16-17-11-8-7-9-12-17)15-10-13-20-22-18(2,3)19(4,5)23-20/h1,7-13H,14-16H2,2-5H3/b13-10+ |
| InChIKey | OKUGXJVZHWWPET-JLHYYAGUSA-N |
| XLogP | 3.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|