C35H38BNO2 — CID 156693279
(E)-N,N-dibenzyl-2,3-diphenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 156693279) has the molecular formula C35H38BNO2 and a molecular weight of 515.51 g/mol. Its IUPAC name is (E)-N,N-dibenzyl-2,3-diphenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | (E)-N,N-dibenzyl-2,3-diphenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 156693279 |
| Molecular Formula | C35H38BNO2 |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | (E)-N,N-dibenzyl-2,3-diphenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CC1(C)OB(/C(=C(\CN(Cc2ccccc2)Cc2ccccc2)c2ccccc2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C35H38BNO2/c1-34(2)35(3,4)39-36(38-34)33(31-23-15-8-16-24-31)32(30-21-13-7-14-22-30)27-37(25-28-17-9-5-10-18-28)26-29-19-11-6-12-20-29/h5-24H,25-27H2,1-4H3/b33-32+ |
| InChIKey | OCOICDMAOFGONS-ULIFNZDWSA-N |
| XLogP | 7.93 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|