C18H29BO2Si — CID 102226563
trimethyl-[(Z)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]silane (PubChem CID 102226563) has the molecular formula C18H29BO2Si and a molecular weight of 316.33 g/mol. Its IUPAC name is trimethyl-[(Z)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]silane.
| Compound Name | trimethyl-[(Z)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]silane |
|---|---|
| PubChem CID | 102226563 |
| Molecular Formula | C18H29BO2Si |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | trimethyl-[(Z)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]silane |
| SMILES | CC1(C)OB(/C(=C/[Si](C)(C)C)Cc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C18H29BO2Si/c1-17(2)18(3,4)21-19(20-17)16(14-22(5,6)7)13-15-11-9-8-10-12-15/h8-12,14H,13H2,1-7H3/b16-14+ |
| InChIKey | PMKWJANRNBQOGZ-JQIJEIRASA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|