C23H29BO2 — CID 46220785
2-[(E)-1,3-diphenylpent-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 46220785) has the molecular formula C23H29BO2 and a molecular weight of 348.30 g/mol. Its IUPAC name is 2-[(E)-1,3-diphenylpent-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-1,3-diphenylpent-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 46220785 |
| Molecular Formula | C23H29BO2 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-[(E)-1,3-diphenylpent-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC/C(=C(\Cc1ccccc1)B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C23H29BO2/c1-6-20(19-15-11-8-12-16-19)21(17-18-13-9-7-10-14-18)24-25-22(2,3)23(4,5)26-24/h7-16H,6,17H2,1-5H3/b21-20- |
| InChIKey | VGTFPQGYTYKRFX-MRCUWXFGSA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|