C28H45B3O6 — CID 132917896
4,4,5,5-tetramethyl-2-[4-phenyl-1,1-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 132917896) has the molecular formula C28H45B3O6 and a molecular weight of 510.10 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-phenyl-1,1-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-phenyl-1,1-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 132917896 |
| Molecular Formula | C28H45B3O6 |
| Molecular Weight | 510.10 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-phenyl-1,1-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(CCc2ccccc2)=C(B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C28H45B3O6/c1-23(2)24(3,4)33-29(32-23)21(19-18-20-16-14-13-15-17-20)22(30-34-25(5,6)26(7,8)35-30)31-36-27(9,10)28(11,12)37-31/h13-17H,18-19H2,1-12H3 |
| InChIKey | WCJIKKQAHABFOI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.10 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|