C28H49BO2Sn — CID 71714704
tritert-butyl-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]stannane (PubChem CID 71714704) has the molecular formula C28H49BO2Sn and a molecular weight of 547.22 g/mol. Its IUPAC name is tritert-butyl-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]stannane.
| Compound Name | tritert-butyl-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]stannane |
|---|---|
| PubChem CID | 71714704 |
| Molecular Formula | C28H49BO2Sn |
| Molecular Weight | 547.22 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | tritert-butyl-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]stannane |
| SMILES | CC/C(B1OC(C)(C)C(C)(C)O1)=C(\c1ccccc1)[Sn](C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H22BO2.3C4H9.Sn/c1-6-14(12-13-10-8-7-9-11-13)17-18-15(2,3)16(4,5)19-17;3*1-4(2)3;/h7-11H,6H2,1-5H3;3*1-3H3; |
| InChIKey | YTBFZTADMAGGEM-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.22 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|