C26H53BO2Sn — CID 71714741
tritert-butyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-2-en-2-yl]stannane (PubChem CID 71714741) has the molecular formula C26H53BO2Sn and a molecular weight of 527.23 g/mol. Its IUPAC name is tritert-butyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-2-en-2-yl]stannane.
| Compound Name | tritert-butyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-2-en-2-yl]stannane |
|---|---|
| PubChem CID | 71714741 |
| Molecular Formula | C26H53BO2Sn |
| Molecular Weight | 527.23 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | tritert-butyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-2-en-2-yl]stannane |
| SMILES | CCCCC/C(B1OC(C)(C)C(C)(C)O1)=C(\C)[Sn](C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26BO2.3C4H9.Sn/c1-7-9-10-11-12(8-2)15-16-13(3,4)14(5,6)17-15;3*1-4(2)3;/h7,9-11H2,1-6H3;3*1-3H3; |
| InChIKey | QTWYYYAFCSBPPI-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.23 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|