C13H27BO3 — CID 154719027
1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-ol (PubChem CID 154719027) has the molecular formula C13H27BO3 and a molecular weight of 242.17 g/mol. Its IUPAC name is 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-ol.
| Compound Name | 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-ol |
|---|---|
| PubChem CID | 154719027 |
| Molecular Formula | C13H27BO3 |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-ol |
| SMILES | CCCCCC(O)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H27BO3/c1-6-7-8-9-11(15)10-14-16-12(2,3)13(4,5)17-14/h11,15H,6-10H2,1-5H3 |
| InChIKey | BSEVHFDEAIGYJL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|