C18H33BO3 — CID 132594455
2-butyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]hexanal (PubChem CID 132594455) has the molecular formula C18H33BO3 and a molecular weight of 308.27 g/mol. Its IUPAC name is 2-butyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]hexanal.
| Compound Name | 2-butyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]hexanal |
|---|---|
| PubChem CID | 132594455 |
| Molecular Formula | C18H33BO3 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2-butyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]hexanal |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)C(C=O)(CCCC)CCCC |
| InChI | InChI=1S/C18H33BO3/c1-8-10-12-18(14-20,13-11-9-2)15(3)19-21-16(4,5)17(6,7)22-19/h14H,3,8-13H2,1-2,4-7H3 |
| InChIKey | QDPKRBXKWDEYPH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|