C12H23BClNO2 — CID 146155084
N-prop-2-enyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine;hydrochloride (PubChem CID 146155084) has the molecular formula C12H23BClNO2 and a molecular weight of 259.59 g/mol. Its IUPAC name is N-prop-2-enyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine;hydrochloride.
| Compound Name | N-prop-2-enyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 146155084 |
| Molecular Formula | C12H23BClNO2 |
| Molecular Weight | 259.59 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N-prop-2-enyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCC(=C)B1OC(C)(C)C(C)(C)O1.Cl |
| InChI | InChI=1S/C12H22BNO2.ClH/c1-7-8-14-9-10(2)13-15-11(3,4)12(5,6)16-13;/h7,14H,1-2,8-9H2,3-6H3;1H |
| InChIKey | NWRGCISPWRENEP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|