C16H25BO3 — CID 153350614
(4E)-7-methyl-3-methylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,4,6-trien-4-ol (PubChem CID 153350614) has the molecular formula C16H25BO3 and a molecular weight of 276.19 g/mol. Its IUPAC name is (4E)-7-methyl-3-methylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,4,6-trien-4-ol.
| Compound Name | (4E)-7-methyl-3-methylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,4,6-trien-4-ol |
|---|---|
| PubChem CID | 153350614 |
| Molecular Formula | C16H25BO3 |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (4E)-7-methyl-3-methylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-1,4,6-trien-4-ol |
| SMILES | C=CC(=C)/C(O)=C(\C=C(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H25BO3/c1-9-12(4)14(18)13(10-11(2)3)17-19-15(5,6)16(7,8)20-17/h9-10,18H,1,4H2,2-3,5-8H3/b14-13- |
| InChIKey | IOARMRNORBFNIU-YPKPFQOOSA-N |
| XLogP | 4.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|