C10H17BO4 — CID 70944716
(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoic acid (PubChem CID 70944716) has the molecular formula C10H17BO4 and a molecular weight of 212.05 g/mol. Its IUPAC name is (Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoic acid.
| Compound Name | (Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 70944716 |
| Molecular Formula | C10H17BO4 |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H17BO4/c1-7(6-8(12)13)11-14-9(2,3)10(4,5)15-11/h6H,1-5H3,(H,12,13)/b7-6+ |
| InChIKey | FSYKAYTUCGGHSD-VOTSOKGWSA-N |
| XLogP | 1.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|