C12H21BN2O2 — CID 144995014
methyl-[(2Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dien-2-yl]diazene (PubChem CID 144995014) has the molecular formula C12H21BN2O2 and a molecular weight of 236.12 g/mol. Its IUPAC name is methyl-[(2Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dien-2-yl]diazene.
| Compound Name | methyl-[(2Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dien-2-yl]diazene |
|---|---|
| PubChem CID | 144995014 |
| Molecular Formula | C12H21BN2O2 |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | methyl-[(2Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dien-2-yl]diazene |
| SMILES | C=C(/C=C(C)\N=N\C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H21BN2O2/c1-9(8-10(2)15-14-7)13-16-11(3,4)12(5,6)17-13/h8H,1H2,2-7H3/b10-8-,15-14+ |
| InChIKey | MVJAPGFLWOYBPB-UCLPZZFCSA-N |
| XLogP | 3.16 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|