C10H19BN2O2 — CID 147392556
N-methyl-N-(methylideneamino)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenamine (PubChem CID 147392556) has the molecular formula C10H19BN2O2 and a molecular weight of 210.09 g/mol. Its IUPAC name is N-methyl-N-(methylideneamino)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenamine.
| Compound Name | N-methyl-N-(methylideneamino)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenamine |
|---|---|
| PubChem CID | 147392556 |
| Molecular Formula | C10H19BN2O2 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-methyl-N-(methylideneamino)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenamine |
| SMILES | C=NN(C)C(=C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H19BN2O2/c1-8(13(7)12-6)11-14-9(2,3)10(4,5)15-11/h1,6H2,2-5,7H3 |
| InChIKey | DNDYYIPDRFFITB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|