C13H22BFO2 — CID 123849356
2-(5-fluoro-2-methylhexa-3,5-dien-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123849356) has the molecular formula C13H22BFO2 and a molecular weight of 240.13 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylhexa-3,5-dien-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(5-fluoro-2-methylhexa-3,5-dien-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123849356 |
| Molecular Formula | C13H22BFO2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-(5-fluoro-2-methylhexa-3,5-dien-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(F)C=C(B1OC(C)(C)C(C)(C)O1)C(C)C |
| InChI | InChI=1S/C13H22BFO2/c1-9(2)11(8-10(3)15)14-16-12(4,5)13(6,7)17-14/h8-9H,3H2,1-2,4-7H3 |
| InChIKey | LTAYNHNSSZPHQY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|