C15H26BNO2 — CID 177171141
(4Z)-2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4,6-trien-3-amine (PubChem CID 177171141) has the molecular formula C15H26BNO2 and a molecular weight of 263.19 g/mol. Its IUPAC name is (4Z)-2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4,6-trien-3-amine.
| Compound Name | (4Z)-2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 177171141 |
| Molecular Formula | C15H26BNO2 |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | (4Z)-2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C(C)/C=C(/B1OC(C)(C)C(C)(C)O1)C(N)=C(C)C |
| InChI | InChI=1S/C15H26BNO2/c1-10(2)9-12(13(17)11(3)4)16-18-14(5,6)15(7,8)19-16/h9H,1,17H2,2-8H3/b12-9+ |
| InChIKey | WCWJXQPFLSNUJW-FMIVXFBMSA-N |
| XLogP | 3.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|