C7H15NO — CID 142851465
(1E)-1-amino-3-methylbuta-1,3-dien-1-ol;ethane (PubChem CID 142851465) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (1E)-1-amino-3-methylbuta-1,3-dien-1-ol;ethane.
| Compound Name | (1E)-1-amino-3-methylbuta-1,3-dien-1-ol;ethane |
|---|---|
| PubChem CID | 142851465 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (1E)-1-amino-3-methylbuta-1,3-dien-1-ol;ethane |
| SMILES | C=C(C)/C=C(\N)O.CC |
| InChI | InChI=1S/C5H9NO.C2H6/c1-4(2)3-5(6)7;1-2/h3,7H,1,6H2,2H3;1-2H3/b5-3+; |
| InChIKey | SWYRJPIMLZSAJL-WGCWOXMQSA-N |
| XLogP | 1.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|