About O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine
O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine (PubChem CID 89191729) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine |
| PubChem CID | 89191729 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine |
| SMILES | C=C(C)/C=C(/C)ON |
| InChI | InChI=1S/C6H11NO/c1-5(2)4-6(3)8-7/h4H,1,7H2,2-3H3/b6-4- |
| InChIKey | KBQBTMISLKPTCF-XQRVVYSFSA-N |
| XLogP | 1.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine?
The IUPAC name of O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine (CID 89191729) is O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine.
What is the SMILES notation for O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine?
The canonical SMILES for O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine is C=C(C)/C=C(/C)ON.
What is the InChIKey of O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine?
The InChIKey is KBQBTMISLKPTCF-XQRVVYSFSA-N. The full InChI is InChI=1S/C6H11NO/c1-5(2)4-6(3)8-7/h4H,1,7H2,2-3H3/b6-4-.
What are the key properties of O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine?
O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine has a molecular weight of 113.16 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine is sourced from PubChem (CID 89191729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).