C6H11NO — CID 89191729
O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine (PubChem CID 89191729) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine.
| Compound Name | O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 89191729 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | O-[(2Z)-4-methylpenta-2,4-dien-2-yl]hydroxylamine |
| SMILES | C=C(C)/C=C(/C)ON |
| InChI | InChI=1S/C6H11NO/c1-5(2)4-6(3)8-7/h4H,1,7H2,2-3H3/b6-4- |
| InChIKey | KBQBTMISLKPTCF-XQRVVYSFSA-N |
| XLogP | 1.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|