C13H17NO2 — CID 145208168
O-[(1E)-1-(5-methoxy-2-methylphenyl)-3-methylbuta-1,3-dienyl]hydroxylamine (PubChem CID 145208168) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is O-[(1E)-1-(5-methoxy-2-methylphenyl)-3-methylbuta-1,3-dienyl]hydroxylamine.
| Compound Name | O-[(1E)-1-(5-methoxy-2-methylphenyl)-3-methylbuta-1,3-dienyl]hydroxylamine |
|---|---|
| PubChem CID | 145208168 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | O-[(1E)-1-(5-methoxy-2-methylphenyl)-3-methylbuta-1,3-dienyl]hydroxylamine |
| SMILES | C=C(C)/C=C(/ON)c1cc(OC)ccc1C |
| InChI | InChI=1S/C13H17NO2/c1-9(2)7-13(16-14)12-8-11(15-4)6-5-10(12)3/h5-8H,1,14H2,2-4H3/b13-7+ |
| InChIKey | SRMHBGDCHIVZRT-NTUHNPAUSA-N |
| XLogP | 2.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|