C10H14O2 — CID 157089381
formaldehyde;4-methoxy-1,2-dimethylbenzene (PubChem CID 157089381) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is formaldehyde;4-methoxy-1,2-dimethylbenzene.
| Compound Name | formaldehyde;4-methoxy-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 157089381 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | formaldehyde;4-methoxy-1,2-dimethylbenzene |
| SMILES | C=O.COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12O.CH2O/c1-7-4-5-9(10-3)6-8(7)2;1-2/h4-6H,1-3H3;1H2 |
| InChIKey | AEMDHPCBWWKUBI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |