C11H16O — CID 145003805
ethene;4-methoxy-1,2-dimethylbenzene (PubChem CID 145003805) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is ethene;4-methoxy-1,2-dimethylbenzene.
| Compound Name | ethene;4-methoxy-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 145003805 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | ethene;4-methoxy-1,2-dimethylbenzene |
| SMILES | C=C.COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12O.C2H4/c1-7-4-5-9(10-3)6-8(7)2;1-2/h4-6H,1-3H3;1-2H2 |
| InChIKey | SMDFBOLHZKEOJO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|