C34H36O4 — CID 102177256
4-methoxy-2-methyl-1-[1,2,2-tris(4-methoxy-2-methylphenyl)ethenyl]benzene (PubChem CID 102177256) has the molecular formula C34H36O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1-[1,2,2-tris(4-methoxy-2-methylphenyl)ethenyl]benzene.
| Compound Name | 4-methoxy-2-methyl-1-[1,2,2-tris(4-methoxy-2-methylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 102177256 |
| Molecular Formula | C34H36O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 4-methoxy-2-methyl-1-[1,2,2-tris(4-methoxy-2-methylphenyl)ethenyl]benzene |
| SMILES | COc1ccc(C(=C(c2ccc(OC)cc2C)c2ccc(OC)cc2C)c2ccc(OC)cc2C)c(C)c1 |
| InChI | InChI=1S/C34H36O4/c1-21-17-25(35-5)9-13-29(21)33(30-14-10-26(36-6)18-22(30)2)34(31-15-11-27(37-7)19-23(31)3)32-16-12-28(38-8)20-24(32)4/h9-20H,1-8H3 |
| InChIKey | SEHCWAAHANQZPU-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|