C14H20O2 — CID 142019265
ethane;(1E)-1-(4-methoxy-2-methylphenyl)buta-1,3-dien-1-ol (PubChem CID 142019265) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is ethane;(1E)-1-(4-methoxy-2-methylphenyl)buta-1,3-dien-1-ol.
| Compound Name | ethane;(1E)-1-(4-methoxy-2-methylphenyl)buta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 142019265 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | ethane;(1E)-1-(4-methoxy-2-methylphenyl)buta-1,3-dien-1-ol |
| SMILES | C=C/C=C(/O)c1ccc(OC)cc1C.CC |
| InChI | InChI=1S/C12H14O2.C2H6/c1-4-5-12(13)11-7-6-10(14-3)8-9(11)2;1-2/h4-8,13H,1H2,2-3H3;1-2H3/b12-5+; |
| InChIKey | VXXJWUBNBCHMML-NKPNRJPBSA-N |
| XLogP | 4.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|