C17H18O4 — CID 114965510
(3,5-dimethoxyphenyl)-(4-methoxy-2-methylphenyl)methanone (PubChem CID 114965510) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(4-methoxy-2-methylphenyl)methanone.
| Compound Name | (3,5-dimethoxyphenyl)-(4-methoxy-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 114965510 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(4-methoxy-2-methylphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)c2ccc(OC)cc2C)c1 |
| InChI | InChI=1S/C17H18O4/c1-11-7-13(19-2)5-6-16(11)17(18)12-8-14(20-3)10-15(9-12)21-4/h5-10H,1-4H3 |
| InChIKey | FBFIHPVCYFIILF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |