C14H14O4 — CID 104789248
(3,5-dimethoxyphenyl)-(2-methylfuran-3-yl)methanone (PubChem CID 104789248) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(2-methylfuran-3-yl)methanone.
| Compound Name | (3,5-dimethoxyphenyl)-(2-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 104789248 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(2-methylfuran-3-yl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)c2ccoc2C)c1 |
| InChI | InChI=1S/C14H14O4/c1-9-13(4-5-18-9)14(15)10-6-11(16-2)8-12(7-10)17-3/h4-8H,1-3H3 |
| InChIKey | NBSPHEDOPWSJHL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |