C15H13ClO3 — CID 24723148
(2-chlorophenyl)-(3,5-dimethoxyphenyl)methanone (PubChem CID 24723148) has the molecular formula C15H13ClO3 and a molecular weight of 276.72 g/mol. Its IUPAC name is (2-chlorophenyl)-(3,5-dimethoxyphenyl)methanone.
| Compound Name | (2-chlorophenyl)-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 24723148 |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (2-chlorophenyl)-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H13ClO3/c1-18-11-7-10(8-12(9-11)19-2)15(17)13-5-3-4-6-14(13)16/h3-9H,1-2H3 |
| InChIKey | RLARQHZLNLKCPR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |