C15H12Br2O3 — CID 115785475
(2,5-dibromophenyl)-(3,5-dimethoxyphenyl)methanone (PubChem CID 115785475) has the molecular formula C15H12Br2O3 and a molecular weight of 400.07 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(3,5-dimethoxyphenyl)methanone.
| Compound Name | (2,5-dibromophenyl)-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 115785475 |
| Molecular Formula | C15H12Br2O3 |
| Molecular Weight | 400.07 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | (2,5-dibromophenyl)-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)c2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C15H12Br2O3/c1-19-11-5-9(6-12(8-11)20-2)15(18)13-7-10(16)3-4-14(13)17/h3-8H,1-2H3 |
| InChIKey | ADAJSYOQEXNHNW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.07 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |