C15H20O — CID 89339234
2-[(3Z)-hepta-1,3-dien-4-yl]-4-methoxy-1-methylbenzene (PubChem CID 89339234) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-[(3Z)-hepta-1,3-dien-4-yl]-4-methoxy-1-methylbenzene.
| Compound Name | 2-[(3Z)-hepta-1,3-dien-4-yl]-4-methoxy-1-methylbenzene |
|---|---|
| PubChem CID | 89339234 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-[(3Z)-hepta-1,3-dien-4-yl]-4-methoxy-1-methylbenzene |
| SMILES | C=C/C=C(/CCC)c1cc(OC)ccc1C |
| InChI | InChI=1S/C15H20O/c1-5-7-13(8-6-2)15-11-14(16-4)10-9-12(15)3/h5,7,9-11H,1,6,8H2,2-4H3/b13-7- |
| InChIKey | HVDZZZHVYXLDJD-QPEQYQDCSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|