C19H26O — CID 145028518
1-butan-2-yl-2-[(2Z)-1-cyclopropylpenta-2,4-dien-2-yl]-4-methoxybenzene (PubChem CID 145028518) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-butan-2-yl-2-[(2Z)-1-cyclopropylpenta-2,4-dien-2-yl]-4-methoxybenzene.
| Compound Name | 1-butan-2-yl-2-[(2Z)-1-cyclopropylpenta-2,4-dien-2-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 145028518 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1-butan-2-yl-2-[(2Z)-1-cyclopropylpenta-2,4-dien-2-yl]-4-methoxybenzene |
| SMILES | C=C/C=C(/CC1CC1)c1cc(OC)ccc1C(C)CC |
| InChI | InChI=1S/C19H26O/c1-5-7-16(12-15-8-9-15)19-13-17(20-4)10-11-18(19)14(3)6-2/h5,7,10-11,13-15H,1,6,8-9,12H2,2-4H3/b16-7- |
| InChIKey | UMEIOYFKIGJBBF-APSNUPSMSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|