C17H22O2 — CID 145208159
4-methoxy-1-methyl-2-[(1E)-3-methyl-1-(2-methylprop-2-enoxy)buta-1,3-dienyl]benzene (PubChem CID 145208159) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-methoxy-1-methyl-2-[(1E)-3-methyl-1-(2-methylprop-2-enoxy)buta-1,3-dienyl]benzene.
| Compound Name | 4-methoxy-1-methyl-2-[(1E)-3-methyl-1-(2-methylprop-2-enoxy)buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 145208159 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 4-methoxy-1-methyl-2-[(1E)-3-methyl-1-(2-methylprop-2-enoxy)buta-1,3-dienyl]benzene |
| SMILES | C=C(C)/C=C(/OCC(=C)C)c1cc(OC)ccc1C |
| InChI | InChI=1S/C17H22O2/c1-12(2)9-17(19-11-13(3)4)16-10-15(18-6)8-7-14(16)5/h7-10H,1,3,11H2,2,4-6H3/b17-9+ |
| InChIKey | WFUGDXMRWMJURF-RQZCQDPDSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|