C16H24O — CID 144511100
ethane;1-[(3E)-hepta-1,3-dien-4-yl]oxy-4-methylbenzene (PubChem CID 144511100) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;1-[(3E)-hepta-1,3-dien-4-yl]oxy-4-methylbenzene.
| Compound Name | ethane;1-[(3E)-hepta-1,3-dien-4-yl]oxy-4-methylbenzene |
|---|---|
| PubChem CID | 144511100 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | ethane;1-[(3E)-hepta-1,3-dien-4-yl]oxy-4-methylbenzene |
| SMILES | C=C/C=C(\CCC)Oc1ccc(C)cc1.CC |
| InChI | InChI=1S/C14H18O.C2H6/c1-4-6-13(7-5-2)15-14-10-8-12(3)9-11-14;1-2/h4,6,8-11H,1,5,7H2,2-3H3;1-2H3/b13-6+; |
| InChIKey | ONXWWVSQLFMMKU-AWFSDRIXSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|