C27H26O2 — CID 142908049
1-methyl-4-[4-[(2Z,4E)-4-(4-methylphenoxy)hepta-2,4,6-trienyl]phenoxy]benzene (PubChem CID 142908049) has the molecular formula C27H26O2 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-methyl-4-[4-[(2Z,4E)-4-(4-methylphenoxy)hepta-2,4,6-trienyl]phenoxy]benzene.
| Compound Name | 1-methyl-4-[4-[(2Z,4E)-4-(4-methylphenoxy)hepta-2,4,6-trienyl]phenoxy]benzene |
|---|---|
| PubChem CID | 142908049 |
| Molecular Formula | C27H26O2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-methyl-4-[4-[(2Z,4E)-4-(4-methylphenoxy)hepta-2,4,6-trienyl]phenoxy]benzene |
| SMILES | C=C/C=C(\C=C/Cc1ccc(Oc2ccc(C)cc2)cc1)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C27H26O2/c1-4-6-24(28-25-15-9-21(2)10-16-25)8-5-7-23-13-19-27(20-14-23)29-26-17-11-22(3)12-18-26/h4-6,8-20H,1,7H2,2-3H3/b8-5-,24-6+ |
| InChIKey | FHIJLLMWNWGFFG-YGEJDLHBSA-N |
| XLogP | 7.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|