C20H36O — CID 177026748
ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene (PubChem CID 177026748) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene.
| Compound Name | ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene |
|---|---|
| PubChem CID | 177026748 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene |
| SMILES | C=C.C=C/C=C(\C)Oc1ccc(C)cc1.CC.CC.CC |
| InChI | InChI=1S/C12H14O.3C2H6.C2H4/c1-4-5-11(3)13-12-8-6-10(2)7-9-12;4*1-2/h4-9H,1H2,2-3H3;3*1-2H3;1-2H2/b11-5+;;;; |
| InChIKey | JURGONVRKPCLGT-NOJKMYKQSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|