About ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene
ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene (PubChem CID 177026748) has the molecular formula C20H36O
and a molecular weight of 292.51 g/mol. Its IUPAC name is ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene.
Molecular Properties
| Compound Name | ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene |
| PubChem CID | 177026748 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene |
| SMILES | C=C.C=C/C=C(\C)Oc1ccc(C)cc1.CC.CC.CC |
| InChI | InChI=1S/C12H14O.3C2H6.C2H4/c1-4-5-11(3)13-12-8-6-10(2)7-9-12;4*1-2/h4-9H,1H2,2-3H3;3*1-2H3;1-2H2/b11-5+;;;; |
| InChIKey | JURGONVRKPCLGT-NOJKMYKQSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene?
The IUPAC name of ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene (CID 177026748) is ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene.
What is the SMILES notation for ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene?
The canonical SMILES for ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene is C=C.C=C/C=C(\C)Oc1ccc(C)cc1.CC.CC.CC.
What is the InChIKey of ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene?
The InChIKey is JURGONVRKPCLGT-NOJKMYKQSA-N. The full InChI is InChI=1S/C12H14O.3C2H6.C2H4/c1-4-5-11(3)13-12-8-6-10(2)7-9-12;4*1-2/h4-9H,1H2,2-3H3;3*1-2H3;1-2H2/b11-5+;;;;.
What are the key properties of ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene?
ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene has a molecular weight of 292.51 g/mol, XLogP of 7.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;1-methyl-4-[(2E)-penta-2,4-dien-2-yl]oxybenzene is sourced from PubChem (CID 177026748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).