C15H18O2 — CID 169209301
2-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxyphenol (PubChem CID 169209301) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxyphenol.
| Compound Name | 2-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxyphenol |
|---|---|
| PubChem CID | 169209301 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxyphenol |
| SMILES | C=C/C(C)=C\C=C(/C)Oc1ccc(O)c(C)c1 |
| InChI | InChI=1S/C15H18O2/c1-5-11(2)6-7-13(4)17-14-8-9-15(16)12(3)10-14/h5-10,16H,1H2,2-4H3/b11-6-,13-7+ |
| InChIKey | XJEDQMTYVVFYAY-LPBBVNJDSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|