C18H26 — CID 177145021
1,2-dimethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]benzene;ethane (PubChem CID 177145021) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1,2-dimethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]benzene;ethane.
| Compound Name | 1,2-dimethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]benzene;ethane |
|---|---|
| PubChem CID | 177145021 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1,2-dimethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]benzene;ethane |
| SMILES | C=C/C(C)=C\C=C(/C)c1ccc(C)c(C)c1.CC |
| InChI | InChI=1S/C16H20.C2H6/c1-6-12(2)7-8-14(4)16-10-9-13(3)15(5)11-16;1-2/h6-11H,1H2,2-5H3;1-2H3/b12-7-,14-8+; |
| InChIKey | CKPPRFLTVYZRSL-BUNXYEDUSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|