C15H19N — CID 170153463
(1Z)-4-(3,4-dimethylphenyl)-2-ethenylpenta-1,4-dien-1-amine (PubChem CID 170153463) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (1Z)-4-(3,4-dimethylphenyl)-2-ethenylpenta-1,4-dien-1-amine.
| Compound Name | (1Z)-4-(3,4-dimethylphenyl)-2-ethenylpenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 170153463 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (1Z)-4-(3,4-dimethylphenyl)-2-ethenylpenta-1,4-dien-1-amine |
| SMILES | C=C/C(=C\N)CC(=C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H19N/c1-5-14(10-16)8-13(4)15-7-6-11(2)12(3)9-15/h5-7,9-10H,1,4,8,16H2,2-3H3/b14-10+ |
| InChIKey | DVUXXZIAMCPDCQ-GXDHUFHOSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|