C35H46O — CID 144517819
4-(3,4-dimethylphenoxy)-1,2-dimethylbenzene;(3Z,5Z,7Z)-7-ethenyl-5-ethylidene-2,3,9,10-tetramethylundeca-1,3,7,9-tetraene (PubChem CID 144517819) has the molecular formula C35H46O and a molecular weight of 482.75 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-1,2-dimethylbenzene;(3Z,5Z,7Z)-7-ethenyl-5-ethylidene-2,3,9,10-tetramethylundeca-1,3,7,9-tetraene.
| Compound Name | 4-(3,4-dimethylphenoxy)-1,2-dimethylbenzene;(3Z,5Z,7Z)-7-ethenyl-5-ethylidene-2,3,9,10-tetramethylundeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 144517819 |
| Molecular Formula | C35H46O |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.35 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-1,2-dimethylbenzene;(3Z,5Z,7Z)-7-ethenyl-5-ethylidene-2,3,9,10-tetramethylundeca-1,3,7,9-tetraene |
| SMILES | C=C/C(=C\C(C)=C(C)C)CC(=C/C)/C=C(/C)C(=C)C.Cc1ccc(Oc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C19H28.C16H18O/c1-9-18(11-16(7)14(3)4)13-19(10-2)12-17(8)15(5)6;1-11-5-7-15(9-13(11)3)17-16-8-6-12(2)14(4)10-16/h9-12H,1,5,13H2,2-4,6-8H3;5-10H,1-4H3/b17-12-,18-11+,19-10+; |
| InChIKey | MVSBPSHOZZZJIY-GFTOJTBRSA-N |
| XLogP | 11.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|