C16H20O — CID 170928678
4-[(1E,3Z)-3,4-dimethylhexa-1,3,5-trienoxy]-1,2-dimethylbenzene (PubChem CID 170928678) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is 4-[(1E,3Z)-3,4-dimethylhexa-1,3,5-trienoxy]-1,2-dimethylbenzene.
| Compound Name | 4-[(1E,3Z)-3,4-dimethylhexa-1,3,5-trienoxy]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 170928678 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 4-[(1E,3Z)-3,4-dimethylhexa-1,3,5-trienoxy]-1,2-dimethylbenzene |
| SMILES | C=C/C(C)=C(C)\C=C\Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H20O/c1-6-12(2)14(4)9-10-17-16-8-7-13(3)15(5)11-16/h6-11H,1H2,2-5H3/b10-9+,14-12- |
| InChIKey | DIOHBFVWUYVYJN-MVFBISMYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|