3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid

C12H14O3 — CID 67542435

IUPAC3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid
SMILESCC(=COc1ccc(C)c(C)c1)C(=O)O
InChIInChI=1S/C12H14O3/c1-8-4-5-11(6-9(8)2)15-7-10(3)12(13)14/h4-7H,1-3H3,(H,13,14)
InChIKeyLFBJNLZLIRGQKP-UHFFFAOYSA-N
MW206.24 g/mol
LogP2.67
Rot. Bonds3

About 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid

3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid (PubChem CID 67542435) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid.

Molecular Properties

Compound Name3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid
PubChem CID67542435
Molecular FormulaC12H14O3
Molecular Weight206.24 g/mol
Exact Mass206.09
IUPAC Name3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid
SMILESCC(=COc1ccc(C)c(C)c1)C(=O)O
InChIInChI=1S/C12H14O3/c1-8-4-5-11(6-9(8)2)15-7-10(3)12(13)14/h4-7H,1-3H3,(H,13,14)
InChIKeyLFBJNLZLIRGQKP-UHFFFAOYSA-N
XLogP2.67
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.24
LogP ≤ 52.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid?
The IUPAC name of 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid (CID 67542435) is 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid.
What is the SMILES notation for 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid?
The canonical SMILES for 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid is CC(=COc1ccc(C)c(C)c1)C(=O)O.
What is the InChIKey of 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid?
The InChIKey is LFBJNLZLIRGQKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-8-4-5-11(6-9(8)2)15-7-10(3)12(13)14/h4-7H,1-3H3,(H,13,14).
What are the key properties of 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid?
3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid has a molecular weight of 206.24 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenoxy)-2-methylprop-2-enoic acid is sourced from PubChem (CID 67542435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).