C17H24O — CID 143523190
ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1,2-dimethylbenzene (PubChem CID 143523190) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1,2-dimethylbenzene.
| Compound Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 143523190 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1,2-dimethylbenzene |
| SMILES | C=C/C=C(\C=C/C)Oc1ccc(C)c(C)c1.CC |
| InChI | InChI=1S/C15H18O.C2H6/c1-5-7-14(8-6-2)16-15-10-9-12(3)13(4)11-15;1-2/h5-11H,1H2,2-4H3;1-2H3/b8-6-,14-7+; |
| InChIKey | BOXLVMFMHSPUOG-UIAFGHFUSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|