C13H13FOS — CID 143815900
4-fluoro-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxybenzenethiol (PubChem CID 143815900) has the molecular formula C13H13FOS and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-fluoro-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxybenzenethiol.
| Compound Name | 4-fluoro-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxybenzenethiol |
|---|---|
| PubChem CID | 143815900 |
| Molecular Formula | C13H13FOS |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-fluoro-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxybenzenethiol |
| SMILES | C=C/C=C(\C=C/C)Oc1cc(S)ccc1F |
| InChI | InChI=1S/C13H13FOS/c1-3-5-10(6-4-2)15-13-9-11(16)7-8-12(13)14/h3-9,16H,1H2,2H3/b6-4-,10-5+ |
| InChIKey | WEQNDEKSUQAAOJ-KNVSICBPSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|