C24H28O2 — CID 143671563
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-4-[2-(4-methoxyphenyl)butan-2-yl]benzene (PubChem CID 143671563) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-4-[2-(4-methoxyphenyl)butan-2-yl]benzene.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-4-[2-(4-methoxyphenyl)butan-2-yl]benzene |
|---|---|
| PubChem CID | 143671563 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-4-[2-(4-methoxyphenyl)butan-2-yl]benzene |
| SMILES | C=C/C=C(\C=C/C)Oc1ccc(C(C)(CC)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H28O2/c1-6-9-22(10-7-2)26-23-17-13-20(14-18-23)24(4,8-3)19-11-15-21(25-5)16-12-19/h6-7,9-18H,1,8H2,2-5H3/b10-7-,22-9+ |
| InChIKey | DLCHCXGJSIDUTK-OYRMVVPWSA-N |
| XLogP | 6.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|