C26H38O — CID 145118363
1-tert-butyl-4-methylbenzene;ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-4-methylbenzene (PubChem CID 145118363) has the molecular formula C26H38O and a molecular weight of 366.59 g/mol. Its IUPAC name is 1-tert-butyl-4-methylbenzene;ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-4-methylbenzene.
| Compound Name | 1-tert-butyl-4-methylbenzene;ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-4-methylbenzene |
|---|---|
| PubChem CID | 145118363 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | 1-tert-butyl-4-methylbenzene;ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-4-methylbenzene |
| SMILES | C/C=C\C(=C/C)Oc1ccc(C)cc1.CC.Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C13H16O.C11H16.C2H6/c1-4-6-12(5-2)14-13-9-7-11(3)8-10-13;1-9-5-7-10(8-6-9)11(2,3)4;1-2/h4-10H,1-3H3;5-8H,1-4H3;1-2H3/b6-4-,12-5+;; |
| InChIKey | ZTESFIVJRJIEEJ-DMLYYHHASA-N |
| XLogP | 8.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|