C15H20O — CID 143551203
1-methyl-4-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]oxybenzene (PubChem CID 143551203) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-methyl-4-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]oxybenzene.
| Compound Name | 1-methyl-4-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]oxybenzene |
|---|---|
| PubChem CID | 143551203 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-methyl-4-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]oxybenzene |
| SMILES | C/C=C\C(=C/C(C)C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C15H20O/c1-5-6-15(11-12(2)3)16-14-9-7-13(4)8-10-14/h5-12H,1-4H3/b6-5-,15-11+ |
| InChIKey | SJCKVLKGQKGISA-UXNHMYCNSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|