C15H18O — CID 143659600
1-methyl-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxybenzene (PubChem CID 143659600) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-methyl-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxybenzene.
| Compound Name | 1-methyl-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxybenzene |
|---|---|
| PubChem CID | 143659600 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-methyl-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxybenzene |
| SMILES | C/C=C\C=C(/C=C\C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C15H18O/c1-4-6-8-14(7-5-2)16-15-11-9-13(3)10-12-15/h4-12H,1-3H3/b6-4-,7-5-,14-8+ |
| InChIKey | GBTMVFWJKUBERM-QAZGFIAXSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|