C28H35OS+ — CID 142964964
ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-[(2Z,4E)-4-(4-methylphenoxy)hepta-2,4,6-trienyl]-phenylsulfanium (PubChem CID 142964964) has the molecular formula C28H35OS+ and a molecular weight of 419.65 g/mol. Its IUPAC name is ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-[(2Z,4E)-4-(4-methylphenoxy)hepta-2,4,6-trienyl]-phenylsulfanium.
| Compound Name | ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-[(2Z,4E)-4-(4-methylphenoxy)hepta-2,4,6-trienyl]-phenylsulfanium |
|---|---|
| PubChem CID | 142964964 |
| Molecular Formula | C28H35OS+ |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-[(2Z,4E)-4-(4-methylphenoxy)hepta-2,4,6-trienyl]-phenylsulfanium |
| SMILES | C=C/C=C(\C=C/C[S+](C(/C=C\C)=C/C)c1ccccc1)Oc1ccc(C)cc1.CC |
| InChI | InChI=1S/C26H29OS.C2H6/c1-5-12-23(27-24-19-17-22(4)18-20-24)14-11-21-28(25(7-3)13-6-2)26-15-9-8-10-16-26;1-2/h5-20H,1,21H2,2-4H3;1-2H3/q+1;/b13-6-,14-11-,23-12+,25-7+; |
| InChIKey | ANOFGWVWGHNNGU-DQMHLMSQSA-N |
| XLogP | 8.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|