C28H26O3 — CID 126710319
(4-methoxyphenyl)-[4-[(3E,5Z)-7-(4-methylphenyl)hepta-1,3,5-trien-4-yl]oxyphenyl]methanone (PubChem CID 126710319) has the molecular formula C28H26O3 and a molecular weight of 410.51 g/mol. Its IUPAC name is (4-methoxyphenyl)-[4-[(3E,5Z)-7-(4-methylphenyl)hepta-1,3,5-trien-4-yl]oxyphenyl]methanone.
| Compound Name | (4-methoxyphenyl)-[4-[(3E,5Z)-7-(4-methylphenyl)hepta-1,3,5-trien-4-yl]oxyphenyl]methanone |
|---|---|
| PubChem CID | 126710319 |
| Molecular Formula | C28H26O3 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (4-methoxyphenyl)-[4-[(3E,5Z)-7-(4-methylphenyl)hepta-1,3,5-trien-4-yl]oxyphenyl]methanone |
| SMILES | C=C/C=C(\C=C/Cc1ccc(C)cc1)Oc1ccc(C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H26O3/c1-4-6-26(8-5-7-22-11-9-21(2)10-12-22)31-27-19-15-24(16-20-27)28(29)23-13-17-25(30-3)18-14-23/h4-6,8-20H,1,7H2,2-3H3/b8-5-,26-6+ |
| InChIKey | PIWJBVQDJXJVLY-CBSHTSOGSA-N |
| XLogP | 6.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|